About 4-chlorobenzenethiol
4-chlorobenzenethiol (PubChem CID 7815) has the molecular formula C6H5ClS
and a molecular weight of 144.63 g/mol. Its IUPAC name is 4-chlorobenzenethiol.
Molecular Properties
| Compound Name | 4-chlorobenzenethiol |
| PubChem CID | 7815 |
| Molecular Formula | C6H5ClS |
| Molecular Weight | 144.63 g/mol |
| Exact Mass | 143.98 |
| IUPAC Name | 4-chlorobenzenethiol |
| SMILES | Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C6H5ClS/c7-5-1-3-6(8)4-2-5/h1-4,8H |
| InChIKey | VZXOZSQDJJNBRC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.63 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorobenzenethiol?
The IUPAC name of 4-chlorobenzenethiol (CID 7815) is 4-chlorobenzenethiol.
What is the SMILES notation for 4-chlorobenzenethiol?
The canonical SMILES for 4-chlorobenzenethiol is Sc1ccc(Cl)cc1.
What is the InChIKey of 4-chlorobenzenethiol?
The InChIKey is VZXOZSQDJJNBRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClS/c7-5-1-3-6(8)4-2-5/h1-4,8H.
What are the key properties of 4-chlorobenzenethiol?
4-chlorobenzenethiol has a molecular weight of 144.63 g/mol, XLogP of 2.63, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorobenzenethiol is sourced from PubChem (CID 7815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).