C21H22FN3O3S — CID 78151142
4-[(2-fluorophenyl)methyl]-3-[5-(4-methylsulfonylphenyl)-1H-imidazol-2-yl]morpholine (PubChem CID 78151142) has the molecular formula C21H22FN3O3S and a molecular weight of 415.49 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)methyl]-3-[5-(4-methylsulfonylphenyl)-1H-imidazol-2-yl]morpholine.
| Compound Name | 4-[(2-fluorophenyl)methyl]-3-[5-(4-methylsulfonylphenyl)-1H-imidazol-2-yl]morpholine |
|---|---|
| PubChem CID | 78151142 |
| Molecular Formula | C21H22FN3O3S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 4-[(2-fluorophenyl)methyl]-3-[5-(4-methylsulfonylphenyl)-1H-imidazol-2-yl]morpholine |
| SMILES | CS(=O)(=O)c1ccc(-c2cnc(C3COCCN3Cc3ccccc3F)[nH]2)cc1 |
| InChI | InChI=1S/C21H22FN3O3S/c1-29(26,27)17-8-6-15(7-9-17)19-12-23-21(24-19)20-14-28-11-10-25(20)13-16-4-2-3-5-18(16)22/h2-9,12,20H,10-11,13-14H2,1H3,(H,23,24) |
| InChIKey | SGWRWHFHIWUPOQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |