C29H39NO8 — CID 78151406
2-(4-methoxy-6,6,9a-trimethyl-5-octa-2,4,6-trienoyloxy-1-oxo-4,5,5a,7,8,9-hexahydro-3H-benzo[e]isoindol-2-yl)pentanedioic acid (PubChem CID 78151406) has the molecular formula C29H39NO8 and a molecular weight of 529.63 g/mol. Its IUPAC name is 2-(4-methoxy-6,6,9a-trimethyl-5-octa-2,4,6-trienoyloxy-1-oxo-4,5,5a,7,8,9-hexahydro-3H-benzo[e]isoindol-2-yl)pentanedioic acid.
| Compound Name | 2-(4-methoxy-6,6,9a-trimethyl-5-octa-2,4,6-trienoyloxy-1-oxo-4,5,5a,7,8,9-hexahydro-3H-benzo[e]isoindol-2-yl)pentanedioic acid |
|---|---|
| PubChem CID | 78151406 |
| Molecular Formula | C29H39NO8 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | 2-(4-methoxy-6,6,9a-trimethyl-5-octa-2,4,6-trienoyloxy-1-oxo-4,5,5a,7,8,9-hexahydro-3H-benzo[e]isoindol-2-yl)pentanedioic acid |
| SMILES | CC=CC=CC=CC(=O)OC1C(OC)C2=C(C(=O)N(C(CCC(=O)O)C(=O)O)C2)C2(C)CCCC(C)(C)C12 |
| InChI | InChI=1S/C29H39NO8/c1-6-7-8-9-10-12-21(33)38-24-23(37-5)18-17-30(19(27(35)36)13-14-20(31)32)26(34)22(18)29(4)16-11-15-28(2,3)25(24)29/h6-10,12,19,23-25H,11,13-17H2,1-5H3,(H,31,32)(H,35,36) |
| InChIKey | FXPWZCUQBSEHTH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|