C12H17N4O2+ — CID 78169135
1,8-dimethyl-3-(2-methylbutyl)purin-3-ium-2,6-dione (PubChem CID 78169135) has the molecular formula C12H17N4O2+ and a molecular weight of 249.29 g/mol. Its IUPAC name is 1,8-dimethyl-3-(2-methylbutyl)purin-3-ium-2,6-dione.
| Compound Name | 1,8-dimethyl-3-(2-methylbutyl)purin-3-ium-2,6-dione |
|---|---|
| PubChem CID | 78169135 |
| Molecular Formula | C12H17N4O2+ |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 1,8-dimethyl-3-(2-methylbutyl)purin-3-ium-2,6-dione |
| SMILES | CCC(C)C[N+]1=C2N=C(C)N=C2C(=O)N(C)C1=O |
| InChI | InChI=1S/C12H17N4O2/c1-5-7(2)6-16-10-9(13-8(3)14-10)11(17)15(4)12(16)18/h7H,5-6H2,1-4H3/q+1 |
| InChIKey | GNYUGOLKTBHJKD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 65.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|