C17H22BrNO3 — CID 7820098
(2R)-2-(4-bromo-2-formylphenoxy)-N-(cyclohexylmethyl)propanamide (PubChem CID 7820098) has the molecular formula C17H22BrNO3 and a molecular weight of 368.27 g/mol. Its IUPAC name is (2R)-2-(4-bromo-2-formylphenoxy)-N-(cyclohexylmethyl)propanamide.
| Compound Name | (2R)-2-(4-bromo-2-formylphenoxy)-N-(cyclohexylmethyl)propanamide |
|---|---|
| PubChem CID | 7820098 |
| Molecular Formula | C17H22BrNO3 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (2R)-2-(4-bromo-2-formylphenoxy)-N-(cyclohexylmethyl)propanamide |
| SMILES | C[C@@H](Oc1ccc(Br)cc1C=O)C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C17H22BrNO3/c1-12(17(21)19-10-13-5-3-2-4-6-13)22-16-8-7-15(18)9-14(16)11-20/h7-9,11-13H,2-6,10H2,1H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | KCBGJUTWESRUIX-GFCCVEGCSA-N |
| XLogP | 3.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|