C18H16BrNO5 — CID 7820033
(2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-(4-bromo-2-formylphenoxy)propanamide (PubChem CID 7820033) has the molecular formula C18H16BrNO5 and a molecular weight of 406.23 g/mol. Its IUPAC name is (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-(4-bromo-2-formylphenoxy)propanamide.
| Compound Name | (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-(4-bromo-2-formylphenoxy)propanamide |
|---|---|
| PubChem CID | 7820033 |
| Molecular Formula | C18H16BrNO5 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-(4-bromo-2-formylphenoxy)propanamide |
| SMILES | C[C@H](Oc1ccc(Br)cc1C=O)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H16BrNO5/c1-11(25-15-5-3-14(19)7-13(15)9-21)18(22)20-8-12-2-4-16-17(6-12)24-10-23-16/h2-7,9,11H,8,10H2,1H3,(H,20,22)/t11-/m0/s1 |
| InChIKey | AOIQFRWKTKGASJ-NSHDSACASA-N |
| XLogP | 3.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|