C15H26N5O2+ — CID 78202610
8-(ethylamino)-7-hexyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 78202610) has the molecular formula C15H26N5O2+ and a molecular weight of 308.41 g/mol. Its IUPAC name is 8-(ethylamino)-7-hexyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-(ethylamino)-7-hexyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78202610 |
| Molecular Formula | C15H26N5O2+ |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 8-(ethylamino)-7-hexyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CCCCCC[N+]1=C(NCC)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C15H25N5O2/c1-5-7-8-9-10-20-11-12(17-14(20)16-6-2)18(3)15(22)19(4)13(11)21/h11H,5-10H2,1-4H3/p+1 |
| InChIKey | WYIMEGSCCSPIQB-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|