C10H18N6O2 — CID 78203583
8-hydrazinyl-3-methyl-7-(2-methylpropyl)-4,5-dihydropurine-2,6-dione (PubChem CID 78203583) has the molecular formula C10H18N6O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 8-hydrazinyl-3-methyl-7-(2-methylpropyl)-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-hydrazinyl-3-methyl-7-(2-methylpropyl)-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78203583 |
| Molecular Formula | C10H18N6O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 8-hydrazinyl-3-methyl-7-(2-methylpropyl)-4,5-dihydropurine-2,6-dione |
| SMILES | CC(C)CN1C(NN)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C10H18N6O2/c1-5(2)4-16-6-7(12-9(16)14-11)15(3)10(18)13-8(6)17/h5-7H,4,11H2,1-3H3,(H,12,14)(H,13,17,18) |
| InChIKey | AXHHBIIIWTXPOA-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|