C12H16N4O4 — CID 78203600
3-(3-methyl-2,6-dioxo-7-prop-2-enyl-4,5-dihydropurin-8-yl)propanoic acid (PubChem CID 78203600) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 3-(3-methyl-2,6-dioxo-7-prop-2-enyl-4,5-dihydropurin-8-yl)propanoic acid.
| Compound Name | 3-(3-methyl-2,6-dioxo-7-prop-2-enyl-4,5-dihydropurin-8-yl)propanoic acid |
|---|---|
| PubChem CID | 78203600 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3-(3-methyl-2,6-dioxo-7-prop-2-enyl-4,5-dihydropurin-8-yl)propanoic acid |
| SMILES | C=CCN1C(CCC(=O)O)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C12H16N4O4/c1-3-6-16-7(4-5-8(17)18)13-10-9(16)11(19)14-12(20)15(10)2/h3,9-10H,1,4-6H2,2H3,(H,17,18)(H,14,19,20) |
| InChIKey | PAODIIUYWJAWJE-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|