C15H17N4O3+ — CID 78205269
9-benzyl-1,3,7-trimethyl-5H-purin-3-ium-2,6,8-trione (PubChem CID 78205269) has the molecular formula C15H17N4O3+ and a molecular weight of 301.33 g/mol. Its IUPAC name is 9-benzyl-1,3,7-trimethyl-5H-purin-3-ium-2,6,8-trione.
| Compound Name | 9-benzyl-1,3,7-trimethyl-5H-purin-3-ium-2,6,8-trione |
|---|---|
| PubChem CID | 78205269 |
| Molecular Formula | C15H17N4O3+ |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 9-benzyl-1,3,7-trimethyl-5H-purin-3-ium-2,6,8-trione |
| SMILES | CN1C(=O)C2C(=[N+](C)C1=O)N(Cc1ccccc1)C(=O)N2C |
| InChI | InChI=1S/C15H17N4O3/c1-16-11-12(17(2)14(21)18(3)13(11)20)19(15(16)22)9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3/q+1 |
| InChIKey | LFCHTZXLEKAKTB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 63.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|