C17H18O4 — CID 78206127
(4-oxo-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-7-yl) acetate (PubChem CID 78206127) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is (4-oxo-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-7-yl) acetate.
| Compound Name | (4-oxo-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-7-yl) acetate |
|---|---|
| PubChem CID | 78206127 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (4-oxo-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-7-yl) acetate |
| SMILES | CC(=O)OC1CCC2C(=O)C(c3ccccc3)=COC2C1 |
| InChI | InChI=1S/C17H18O4/c1-11(18)21-13-7-8-14-16(9-13)20-10-15(17(14)19)12-5-3-2-4-6-12/h2-6,10,13-14,16H,7-9H2,1H3 |
| InChIKey | XQMKXAMBYAOSJL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |