C11H13N3OS — CID 78207253
6-amino-1-(4-methylphenyl)-2-sulfanylidene-1,3-diazinan-4-one (PubChem CID 78207253) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 6-amino-1-(4-methylphenyl)-2-sulfanylidene-1,3-diazinan-4-one.
| Compound Name | 6-amino-1-(4-methylphenyl)-2-sulfanylidene-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 78207253 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 6-amino-1-(4-methylphenyl)-2-sulfanylidene-1,3-diazinan-4-one |
| SMILES | Cc1ccc(N2C(=S)NC(=O)CC2N)cc1 |
| InChI | InChI=1S/C11H13N3OS/c1-7-2-4-8(5-3-7)14-9(12)6-10(15)13-11(14)16/h2-5,9H,6,12H2,1H3,(H,13,15,16) |
| InChIKey | AHDALDBPTPZRHU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|