C21H21ClN6O — CID 78210203
6-chloro-N-(1H-indazol-6-yl)-8-(piperidin-3-ylmethoxy)quinazolin-2-amine (PubChem CID 78210203) has the molecular formula C21H21ClN6O and a molecular weight of 408.89 g/mol. Its IUPAC name is 6-chloro-N-(1H-indazol-6-yl)-8-(piperidin-3-ylmethoxy)quinazolin-2-amine.
| Compound Name | 6-chloro-N-(1H-indazol-6-yl)-8-(piperidin-3-ylmethoxy)quinazolin-2-amine |
|---|---|
| PubChem CID | 78210203 |
| Molecular Formula | C21H21ClN6O |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 6-chloro-N-(1H-indazol-6-yl)-8-(piperidin-3-ylmethoxy)quinazolin-2-amine |
| SMILES | Clc1cc(OCC2CCCNC2)c2nc(Nc3ccc4cn[nH]c4c3)ncc2c1 |
| InChI | InChI=1S/C21H21ClN6O/c22-16-6-15-10-24-21(26-17-4-3-14-11-25-28-18(14)8-17)27-20(15)19(7-16)29-12-13-2-1-5-23-9-13/h3-4,6-8,10-11,13,23H,1-2,5,9,12H2,(H,25,28)(H,24,26,27) |
| InChIKey | LDRRWPZMHCGGFV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 87.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |