C29H34Cl2N4O2S — CID 78225573
(2S)-1-[(2R,3S,5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-3,5-dihydro-2H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 78225573) has the molecular formula C29H34Cl2N4O2S and a molecular weight of 573.59 g/mol. Its IUPAC name is (2S)-1-[(2R,3S,5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-3,5-dihydro-2H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2R,3S,5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-3,5-dihydro-2H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 78225573 |
| Molecular Formula | C29H34Cl2N4O2S |
| Molecular Weight | 573.59 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | (2S)-1-[(2R,3S,5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-3,5-dihydro-2H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CC(C)[C@H]1[C@H](C(=O)N2CCC[C@H]2C(=O)N(C)C)SC2=N[C@@](C)(c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C29H34Cl2N4O2S/c1-17(2)23-24(27(37)34-16-6-7-22(34)26(36)33(4)5)38-28-32-29(3,19-10-14-21(31)15-11-19)25(35(23)28)18-8-12-20(30)13-9-18/h8-15,17,22-25H,6-7,16H2,1-5H3/t22-,23-,24+,25+,29-/m0/s1 |
| InChIKey | LLEJOQXSESTVSU-SNRQIKIQSA-N |
| XLogP | 5.84 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.59 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |