C21H20Cl2N2O2S — CID 143691995
(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole-2-carboxylic acid (PubChem CID 143691995) has the molecular formula C21H20Cl2N2O2S and a molecular weight of 435.38 g/mol. Its IUPAC name is (5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole-2-carboxylic acid.
| Compound Name | (5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 143691995 |
| Molecular Formula | C21H20Cl2N2O2S |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | (5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole-2-carboxylic acid |
| SMILES | CC(C)C1C(C(=O)O)SC2=N[C@@H](c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C21H20Cl2N2O2S/c1-11(2)17-19(20(26)27)28-21-24-16(12-3-7-14(22)8-4-12)18(25(17)21)13-5-9-15(23)10-6-13/h3-11,16-19H,1-2H3,(H,26,27)/t16-,17?,18+,19?/m0/s1 |
| InChIKey | RCFWSFCMTNLGQZ-BKVYNOPKSA-N |
| XLogP | 5.67 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |