C27H29Cl2N3O3S — CID 143692088
2-[[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]-(2-methylpropyl)amino]acetic acid (PubChem CID 143692088) has the molecular formula C27H29Cl2N3O3S and a molecular weight of 546.52 g/mol. Its IUPAC name is 2-[[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]-(2-methylpropyl)amino]acetic acid.
| Compound Name | 2-[[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]-(2-methylpropyl)amino]acetic acid |
|---|---|
| PubChem CID | 143692088 |
| Molecular Formula | C27H29Cl2N3O3S |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 2-[[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]-(2-methylpropyl)amino]acetic acid |
| SMILES | CC(C)CN(CC(=O)O)C(=O)C1=C(C(C)C)N2C(=N[C@@H](c3ccc(Cl)cc3)[C@H]2c2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C27H29Cl2N3O3S/c1-15(2)13-31(14-21(33)34)26(35)25-23(16(3)4)32-24(18-7-11-20(29)12-8-18)22(30-27(32)36-25)17-5-9-19(28)10-6-17/h5-12,15-16,22,24H,13-14H2,1-4H3,(H,33,34)/t22-,24+/m0/s1 |
| InChIKey | CUIIOVYDVBVXQR-LADGPHEKSA-N |
| XLogP | 6.63 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |