C27H28Cl2N4O2S — CID 143692049
(2S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]-N,N-dimethylazetidine-2-carboxamide (PubChem CID 143692049) has the molecular formula C27H28Cl2N4O2S and a molecular weight of 543.52 g/mol. Its IUPAC name is (2S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]-N,N-dimethylazetidine-2-carboxamide.
| Compound Name | (2S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]-N,N-dimethylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 143692049 |
| Molecular Formula | C27H28Cl2N4O2S |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | (2S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]-N,N-dimethylazetidine-2-carboxamide |
| SMILES | CC(C)C1=C(C(=O)N2CC[C@H]2C(=O)N(C)C)SC2=N[C@@H](c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C27H28Cl2N4O2S/c1-15(2)22-24(26(35)32-14-13-20(32)25(34)31(3)4)36-27-30-21(16-5-9-18(28)10-6-16)23(33(22)27)17-7-11-19(29)12-8-17/h5-12,15,20-21,23H,13-14H2,1-4H3/t20-,21-,23+/m0/s1 |
| InChIKey | NLMYQSIHADPBDU-QNWVGRARSA-N |
| XLogP | 5.75 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |