C27H27Cl2N5O3S — CID 143692194
carbamoyl (2S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]pyrrolidine-2-carboximidate (PubChem CID 143692194) has the molecular formula C27H27Cl2N5O3S and a molecular weight of 572.52 g/mol. Its IUPAC name is carbamoyl (2S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]pyrrolidine-2-carboximidate.
| Compound Name | carbamoyl (2S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]pyrrolidine-2-carboximidate |
|---|---|
| PubChem CID | 143692194 |
| Molecular Formula | C27H27Cl2N5O3S |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | carbamoyl (2S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]pyrrolidine-2-carboximidate |
| SMILES | [H]/N=C(\OC(N)=O)[C@@H]1CCCN1C(=O)C1=C(C(C)C)N2C(=N[C@@H](c3ccc(Cl)cc3)[C@H]2c2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C27H27Cl2N5O3S/c1-14(2)21-23(25(35)33-13-3-4-19(33)24(30)37-26(31)36)38-27-32-20(15-5-9-17(28)10-6-15)22(34(21)27)16-7-11-18(29)12-8-16/h5-12,14,19-20,22,30H,3-4,13H2,1-2H3,(H2,31,36)/b30-24-/t19-,20-,22+/m0/s1 |
| InChIKey | ZUKHEZGSOJJVSL-PVOQVZRCSA-N |
| XLogP | 6.13 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|