C26H28Cl2N4OS — CID 143692244
4-[1-[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazol-2-yl]ethyl]piperazin-2-one (PubChem CID 143692244) has the molecular formula C26H28Cl2N4OS and a molecular weight of 515.51 g/mol. Its IUPAC name is 4-[1-[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazol-2-yl]ethyl]piperazin-2-one.
| Compound Name | 4-[1-[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazol-2-yl]ethyl]piperazin-2-one |
|---|---|
| PubChem CID | 143692244 |
| Molecular Formula | C26H28Cl2N4OS |
| Molecular Weight | 515.51 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 4-[1-[(5R,6S)-5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazol-2-yl]ethyl]piperazin-2-one |
| SMILES | CC(C)C1=C(C(C)N2CCNC(=O)C2)SC2=N[C@@H](c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C26H28Cl2N4OS/c1-15(2)23-25(16(3)31-13-12-29-21(33)14-31)34-26-30-22(17-4-8-19(27)9-5-17)24(32(23)26)18-6-10-20(28)11-7-18/h4-11,15-16,22,24H,12-14H2,1-3H3,(H,29,33)/t16?,22-,24+/m0/s1 |
| InChIKey | DMYGRWAZFZZPQR-XWOBEDNTSA-N |
| XLogP | 5.88 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |