C26H26Cl2N4O2S — CID 58007479
1-[5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]-1,4-diazepan-5-one (PubChem CID 58007479) has the molecular formula C26H26Cl2N4O2S and a molecular weight of 529.49 g/mol. Its IUPAC name is 1-[5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]-1,4-diazepan-5-one.
| Compound Name | 1-[5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 58007479 |
| Molecular Formula | C26H26Cl2N4O2S |
| Molecular Weight | 529.49 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 1-[5,6-bis(4-chlorophenyl)-3-propan-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbonyl]-1,4-diazepan-5-one |
| SMILES | CC(C)C1=C(C(=O)N2CCNC(=O)CC2)SC2=NC(c3ccc(Cl)cc3)C(c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C26H26Cl2N4O2S/c1-15(2)22-24(25(34)31-13-11-20(33)29-12-14-31)35-26-30-21(16-3-7-18(27)8-4-16)23(32(22)26)17-5-9-19(28)10-6-17/h3-10,15,21,23H,11-14H2,1-2H3,(H,29,33) |
| InChIKey | VGAAMXDVLNPTSK-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |