About 1,2,6-Hexanetriol
1,2,6-Hexanetriol (PubChem CID 7823) has the molecular formula C6H14O3
and a molecular weight of 134.17 g/mol. Its IUPAC name is hexane-1,2,6-triol.
Molecular Properties
| Compound Name | 1,2,6-Hexanetriol |
| PubChem CID | 7823 |
| Molecular Formula | C6H14O3 |
| Molecular Weight | 134.17 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | hexane-1,2,6-triol |
| SMILES | C(CCO)CC(CO)O |
| InChI | InChI=1S/C6H14O3/c7-4-2-1-3-6(9)5-8/h6-9H,1-5H2 |
| InChIKey | ZWVMLYRJXORSEP-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | 56 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.17 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,2,6-Hexanetriol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,6-Hexanetriol?
The IUPAC name of 1,2,6-Hexanetriol (CID 7823) is hexane-1,2,6-triol.
What is the SMILES notation for 1,2,6-Hexanetriol?
The canonical SMILES for 1,2,6-Hexanetriol is C(CCO)CC(CO)O.
What is the InChIKey of 1,2,6-Hexanetriol?
The InChIKey is ZWVMLYRJXORSEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3/c7-4-2-1-3-6(9)5-8/h6-9H,1-5H2.
What are the key properties of 1,2,6-Hexanetriol?
1,2,6-Hexanetriol has a molecular weight of 134.17 g/mol, XLogP of -0.70, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,6-Hexanetriol is sourced from PubChem (CID 7823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).