C14H21N6O3+ — CID 78248741
(1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(3-morpholin-4-ylpropyl)azanium (PubChem CID 78248741) has the molecular formula C14H21N6O3+ and a molecular weight of 321.36 g/mol. Its IUPAC name is (1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(3-morpholin-4-ylpropyl)azanium.
| Compound Name | (1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(3-morpholin-4-ylpropyl)azanium |
|---|---|
| PubChem CID | 78248741 |
| Molecular Formula | C14H21N6O3+ |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(3-morpholin-4-ylpropyl)azanium |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)=N/C(=[NH+]/CCCN1CCOCC1)N=2 |
| InChI | InChI=1S/C14H20N6O3/c1-18-11-10(12(21)19(2)14(18)22)16-13(17-11)15-4-3-5-20-6-8-23-9-7-20/h3-9H2,1-2H3/p+1/b15-13+ |
| InChIKey | LSKBMIKAGQOARI-FYWRMAATSA-O |
| XLogP | -4.50 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | -4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|