C10H5F5N2O — CID 78294277
3-(1,1,2,2,2-pentafluoroethyl)-4aH-quinoxalin-2-one (PubChem CID 78294277) has the molecular formula C10H5F5N2O and a molecular weight of 264.15 g/mol. Its IUPAC name is 3-(1,1,2,2,2-pentafluoroethyl)-4aH-quinoxalin-2-one.
| Compound Name | 3-(1,1,2,2,2-pentafluoroethyl)-4aH-quinoxalin-2-one |
|---|---|
| PubChem CID | 78294277 |
| Molecular Formula | C10H5F5N2O |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 3-(1,1,2,2,2-pentafluoroethyl)-4aH-quinoxalin-2-one |
| SMILES | O=C1N=C2C=CC=CC2N=C1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H5F5N2O/c11-9(12,10(13,14)15)7-8(18)17-6-4-2-1-3-5(6)16-7/h1-5H |
| InChIKey | FXTBSEWIFRJICA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|