C25H26N2O8 — CID 78295664
N-(4-methoxy-2-nitrophenyl)-2-[[3-(4-methylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetamide (PubChem CID 78295664) has the molecular formula C25H26N2O8 and a molecular weight of 482.49 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-2-[[3-(4-methylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetamide.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-2-[[3-(4-methylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetamide |
|---|---|
| PubChem CID | 78295664 |
| Molecular Formula | C25H26N2O8 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-2-[[3-(4-methylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]acetamide |
| SMILES | COc1ccc(NC(=O)COC2CCC3C(=O)C(Oc4ccc(C)cc4)=COC3C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H26N2O8/c1-15-3-5-16(6-4-15)35-23-13-34-22-12-18(7-9-19(22)25(23)29)33-14-24(28)26-20-10-8-17(32-2)11-21(20)27(30)31/h3-6,8,10-11,13,18-19,22H,7,9,12,14H2,1-2H3,(H,26,28) |
| InChIKey | SCZLYDLFNCMHQI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|