C18H23ClN4O2S — CID 7829588
1-[2-(5-chloro-1-propylbenzimidazol-2-yl)sulfanylacetyl]piperidine-4-carboxamide (PubChem CID 7829588) has the molecular formula C18H23ClN4O2S and a molecular weight of 394.93 g/mol. Its IUPAC name is 1-[2-(5-chloro-1-propylbenzimidazol-2-yl)sulfanylacetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(5-chloro-1-propylbenzimidazol-2-yl)sulfanylacetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 7829588 |
| Molecular Formula | C18H23ClN4O2S |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 1-[2-(5-chloro-1-propylbenzimidazol-2-yl)sulfanylacetyl]piperidine-4-carboxamide |
| SMILES | CCCn1c(SCC(=O)N2CCC(C(N)=O)CC2)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H23ClN4O2S/c1-2-7-23-15-4-3-13(19)10-14(15)21-18(23)26-11-16(24)22-8-5-12(6-9-22)17(20)25/h3-4,10,12H,2,5-9,11H2,1H3,(H2,20,25) |
| InChIKey | BOHBAYNWHYQVTG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |