C21H20N5O3S+ — CID 78314152
N-naphthalen-1-yl-2-[(1,3,7-trimethyl-2,4-dioxo-4aH-pyrimido[4,5-d]pyrimidin-1-ium-5-yl)sulfanyl]acetamide (PubChem CID 78314152) has the molecular formula C21H20N5O3S+ and a molecular weight of 422.49 g/mol. Its IUPAC name is N-naphthalen-1-yl-2-[(1,3,7-trimethyl-2,4-dioxo-4aH-pyrimido[4,5-d]pyrimidin-1-ium-5-yl)sulfanyl]acetamide.
| Compound Name | N-naphthalen-1-yl-2-[(1,3,7-trimethyl-2,4-dioxo-4aH-pyrimido[4,5-d]pyrimidin-1-ium-5-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 78314152 |
| Molecular Formula | C21H20N5O3S+ |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-naphthalen-1-yl-2-[(1,3,7-trimethyl-2,4-dioxo-4aH-pyrimido[4,5-d]pyrimidin-1-ium-5-yl)sulfanyl]acetamide |
| SMILES | CC1=NC2=[N+](C)C(=O)N(C)C(=O)C2C(SCC(=O)Nc2cccc3ccccc23)=N1 |
| InChI | InChI=1S/C21H19N5O3S/c1-12-22-18-17(20(28)26(3)21(29)25(18)2)19(23-12)30-11-16(27)24-15-10-6-8-13-7-4-5-9-14(13)15/h4-10,17H,11H2,1-3H3/p+1 |
| InChIKey | OMFUTKCDDBAYPS-UHFFFAOYSA-O |
| XLogP | 2.59 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|