C23H20ClNO3 — CID 78319440
4-[[5-(3-chlorophenyl)-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid (PubChem CID 78319440) has the molecular formula C23H20ClNO3 and a molecular weight of 393.87 g/mol. Its IUPAC name is 4-[[5-(3-chlorophenyl)-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid.
| Compound Name | 4-[[5-(3-chlorophenyl)-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 78319440 |
| Molecular Formula | C23H20ClNO3 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 4-[[5-(3-chlorophenyl)-2-methylbenzoyl]amino]-3,5-dimethylbenzoic acid |
| SMILES | Cc1ccc(-c2cccc(Cl)c2)cc1C(=O)Nc1c(C)cc(C(=O)O)cc1C |
| InChI | InChI=1S/C23H20ClNO3/c1-13-7-8-17(16-5-4-6-19(24)11-16)12-20(13)22(26)25-21-14(2)9-18(23(27)28)10-15(21)3/h4-12H,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | QCLQEQGYDPFKTF-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |