C21H15Cl2NO3 — CID 78319441
4-[[2-chloro-5-(3-chlorophenyl)benzoyl]amino]-3-methylbenzoic acid (PubChem CID 78319441) has the molecular formula C21H15Cl2NO3 and a molecular weight of 400.26 g/mol. Its IUPAC name is 4-[[2-chloro-5-(3-chlorophenyl)benzoyl]amino]-3-methylbenzoic acid.
| Compound Name | 4-[[2-chloro-5-(3-chlorophenyl)benzoyl]amino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 78319441 |
| Molecular Formula | C21H15Cl2NO3 |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 4-[[2-chloro-5-(3-chlorophenyl)benzoyl]amino]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1NC(=O)c1cc(-c2cccc(Cl)c2)ccc1Cl |
| InChI | InChI=1S/C21H15Cl2NO3/c1-12-9-15(21(26)27)6-8-19(12)24-20(25)17-11-14(5-7-18(17)23)13-3-2-4-16(22)10-13/h2-11H,1H3,(H,24,25)(H,26,27) |
| InChIKey | YQUMDNXCTRVATM-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |