C22H17Cl2NO4 — CID 78319377
3,5-dichloro-4-[[5-(3-methoxyphenyl)-2-methylbenzoyl]amino]benzoic acid (PubChem CID 78319377) has the molecular formula C22H17Cl2NO4 and a molecular weight of 430.29 g/mol. Its IUPAC name is 3,5-dichloro-4-[[5-(3-methoxyphenyl)-2-methylbenzoyl]amino]benzoic acid.
| Compound Name | 3,5-dichloro-4-[[5-(3-methoxyphenyl)-2-methylbenzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 78319377 |
| Molecular Formula | C22H17Cl2NO4 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 3,5-dichloro-4-[[5-(3-methoxyphenyl)-2-methylbenzoyl]amino]benzoic acid |
| SMILES | COc1cccc(-c2ccc(C)c(C(=O)Nc3c(Cl)cc(C(=O)O)cc3Cl)c2)c1 |
| InChI | InChI=1S/C22H17Cl2NO4/c1-12-6-7-14(13-4-3-5-16(8-13)29-2)9-17(12)21(26)25-20-18(23)10-15(22(27)28)11-19(20)24/h3-11H,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | YYFCPAHQPLLTFU-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |