C25H18N4O3 — CID 78322440
methyl N-[3-[2-[(E)-2-(4-cyanophenyl)ethenyl]-4-oxoquinazolin-3-yl]phenyl]carbamate (PubChem CID 78322440) has the molecular formula C25H18N4O3 and a molecular weight of 422.44 g/mol. Its IUPAC name is methyl N-[3-[2-[(E)-2-(4-cyanophenyl)ethenyl]-4-oxoquinazolin-3-yl]phenyl]carbamate.
| Compound Name | methyl N-[3-[2-[(E)-2-(4-cyanophenyl)ethenyl]-4-oxoquinazolin-3-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 78322440 |
| Molecular Formula | C25H18N4O3 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | methyl N-[3-[2-[(E)-2-(4-cyanophenyl)ethenyl]-4-oxoquinazolin-3-yl]phenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(-n2c(/C=C/c3ccc(C#N)cc3)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C25H18N4O3/c1-32-25(31)27-19-5-4-6-20(15-19)29-23(14-13-17-9-11-18(16-26)12-10-17)28-22-8-3-2-7-21(22)24(29)30/h2-15H,1H3,(H,27,31)/b14-13+ |
| InChIKey | JLYVIUGYPFMZGE-BUHFOSPRSA-N |
| XLogP | 4.61 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |