C20H13N5O — CID 118860759
4-[(E)-2-[4-oxo-3-(1H-pyrazol-5-yl)quinazolin-2-yl]ethenyl]benzonitrile (PubChem CID 118860759) has the molecular formula C20H13N5O and a molecular weight of 339.36 g/mol. Its IUPAC name is 4-[(E)-2-[4-oxo-3-(1H-pyrazol-5-yl)quinazolin-2-yl]ethenyl]benzonitrile.
| Compound Name | 4-[(E)-2-[4-oxo-3-(1H-pyrazol-5-yl)quinazolin-2-yl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 118860759 |
| Molecular Formula | C20H13N5O |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 4-[(E)-2-[4-oxo-3-(1H-pyrazol-5-yl)quinazolin-2-yl]ethenyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=C/c2nc3ccccc3c(=O)n2-c2ccn[nH]2)cc1 |
| InChI | InChI=1S/C20H13N5O/c21-13-15-7-5-14(6-8-15)9-10-18-23-17-4-2-1-3-16(17)20(26)25(18)19-11-12-22-24-19/h1-12H,(H,22,24)/b10-9+ |
| InChIKey | RYXAKKDZEIAQQH-MDZDMXLPSA-N |
| XLogP | 3.15 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |