C19H17N3O3 — CID 78340944
N-cyclopropyl-4-[(2,4-dioxo-4aH-quinazolin-3-yl)methyl]benzamide (PubChem CID 78340944) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is N-cyclopropyl-4-[(2,4-dioxo-4aH-quinazolin-3-yl)methyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(2,4-dioxo-4aH-quinazolin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 78340944 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-cyclopropyl-4-[(2,4-dioxo-4aH-quinazolin-3-yl)methyl]benzamide |
| SMILES | O=C(NC1CC1)c1ccc(CN2C(=O)N=C3C=CC=CC3C2=O)cc1 |
| InChI | InChI=1S/C19H17N3O3/c23-17(20-14-9-10-14)13-7-5-12(6-8-13)11-22-18(24)15-3-1-2-4-16(15)21-19(22)25/h1-8,14-15H,9-11H2,(H,20,23) |
| InChIKey | SSEHCWCLZOHUGE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |