C23H25N3O4 — CID 78350471
2-(3-aminopropoxy)-4-(3-hydroxy-5-methoxyanilino)-N-phenylbenzamide (PubChem CID 78350471) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-(3-aminopropoxy)-4-(3-hydroxy-5-methoxyanilino)-N-phenylbenzamide.
| Compound Name | 2-(3-aminopropoxy)-4-(3-hydroxy-5-methoxyanilino)-N-phenylbenzamide |
|---|---|
| PubChem CID | 78350471 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-(3-aminopropoxy)-4-(3-hydroxy-5-methoxyanilino)-N-phenylbenzamide |
| SMILES | COc1cc(O)cc(Nc2ccc(C(=O)Nc3ccccc3)c(OCCCN)c2)c1 |
| InChI | InChI=1S/C23H25N3O4/c1-29-20-13-18(12-19(27)15-20)25-17-8-9-21(22(14-17)30-11-5-10-24)23(28)26-16-6-3-2-4-7-16/h2-4,6-9,12-15,25,27H,5,10-11,24H2,1H3,(H,26,28) |
| InChIKey | TUABKEMVLJKHPG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|