C19H26N8O3S — CID 78351082
1-[3-methyl-2,6-dioxo-7-(3-pyrimidin-2-ylsulfanylpropyl)-4,5-dihydropurin-8-yl]piperidine-4-carboxamide (PubChem CID 78351082) has the molecular formula C19H26N8O3S and a molecular weight of 446.54 g/mol. Its IUPAC name is 1-[3-methyl-2,6-dioxo-7-(3-pyrimidin-2-ylsulfanylpropyl)-4,5-dihydropurin-8-yl]piperidine-4-carboxamide.
| Compound Name | 1-[3-methyl-2,6-dioxo-7-(3-pyrimidin-2-ylsulfanylpropyl)-4,5-dihydropurin-8-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78351082 |
| Molecular Formula | C19H26N8O3S |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 1-[3-methyl-2,6-dioxo-7-(3-pyrimidin-2-ylsulfanylpropyl)-4,5-dihydropurin-8-yl]piperidine-4-carboxamide |
| SMILES | CN1C(=O)NC(=O)C2C1N=C(N1CCC(C(N)=O)CC1)N2CCCSc1ncccn1 |
| InChI | InChI=1S/C19H26N8O3S/c1-25-15-13(16(29)24-19(25)30)27(8-3-11-31-17-21-6-2-7-22-17)18(23-15)26-9-4-12(5-10-26)14(20)28/h2,6-7,12-13,15H,3-5,8-11H2,1H3,(H2,20,28)(H,24,29,30) |
| InChIKey | OFDLBKZRHAJLMP-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 137.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|