C22H38N5O2+ — CID 78376921
8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-heptyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 78376921) has the molecular formula C22H38N5O2+ and a molecular weight of 404.58 g/mol. Its IUPAC name is 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-heptyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-heptyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78376921 |
| Molecular Formula | C22H38N5O2+ |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.30 |
| IUPAC Name | 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-heptyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CCCCCCC[N+]1=C(CN2CC(C)CC(C)C2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C22H38N5O2/c1-6-7-8-9-10-11-27-18(15-26-13-16(2)12-17(3)14-26)23-20-19(27)21(28)25(5)22(29)24(20)4/h16-17,19H,6-15H2,1-5H3/q+1 |
| InChIKey | HVEJJTOAWRBQEA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|