C29H40O6 — CID 78384868
[4-(3,7-dimethylocta-2,6-dienyl)-2-(3-methylbut-2-enyl)-5-(2-methylpropanoyloxy)-3,6-dioxocyclohexa-1,4-dien-1-yl] 2-methylpropanoate (PubChem CID 78384868) has the molecular formula C29H40O6 and a molecular weight of 484.63 g/mol. Its IUPAC name is [4-(3,7-dimethylocta-2,6-dienyl)-2-(3-methylbut-2-enyl)-5-(2-methylpropanoyloxy)-3,6-dioxocyclohexa-1,4-dien-1-yl] 2-methylpropanoate.
| Compound Name | [4-(3,7-dimethylocta-2,6-dienyl)-2-(3-methylbut-2-enyl)-5-(2-methylpropanoyloxy)-3,6-dioxocyclohexa-1,4-dien-1-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 78384868 |
| Molecular Formula | C29H40O6 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | [4-(3,7-dimethylocta-2,6-dienyl)-2-(3-methylbut-2-enyl)-5-(2-methylpropanoyloxy)-3,6-dioxocyclohexa-1,4-dien-1-yl] 2-methylpropanoate |
| SMILES | CC(C)=CCCC(C)=CCC1=C(OC(=O)C(C)C)C(=O)C(OC(=O)C(C)C)=C(CC=C(C)C)C1=O |
| InChI | InChI=1S/C29H40O6/c1-17(2)11-10-12-21(9)14-16-23-24(30)22(15-13-18(3)4)26(34-28(32)19(5)6)25(31)27(23)35-29(33)20(7)8/h11,13-14,19-20H,10,12,15-16H2,1-9H3 |
| InChIKey | LLCTZEXRKYOVJM-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|