About [(1R)-2-oxocyclohexyl] 2-(4-benzoylphenoxy)acetate
[(1R)-2-oxocyclohexyl] 2-(4-benzoylphenoxy)acetate (PubChem CID 7839651) has the molecular formula C21H20O5
and a molecular weight of 352.39 g/mol. Its IUPAC name is [(1R)-2-oxocyclohexyl] 2-(4-benzoylphenoxy)acetate.
Molecular Properties
| Compound Name | [(1R)-2-oxocyclohexyl] 2-(4-benzoylphenoxy)acetate |
| PubChem CID | 7839651 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | [(1R)-2-oxocyclohexyl] 2-(4-benzoylphenoxy)acetate |
| SMILES | O=C(COc1ccc(C(=O)c2ccccc2)cc1)O[C@@H]1CCCCC1=O |
| InChI | InChI=1S/C21H20O5/c22-18-8-4-5-9-19(18)26-20(23)14-25-17-12-10-16(11-13-17)21(24)15-6-2-1-3-7-15/h1-3,6-7,10-13,19H,4-5,8-9,14H2/t19-/m1/s1 |
| InChIKey | SEKAIBGIVYHIBX-LJQANCHMSA-N |
| XLogP | 3.35 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1R)-2-oxocyclohexyl] 2-(4-benzoylphenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-2-oxocyclohexyl] 2-(4-benzoylphenoxy)acetate?
The IUPAC name of [(1R)-2-oxocyclohexyl] 2-(4-benzoylphenoxy)acetate (CID 7839651) is [(1R)-2-oxocyclohexyl] 2-(4-benzoylphenoxy)acetate.
What is the SMILES notation for [(1R)-2-oxocyclohexyl] 2-(4-benzoylphenoxy)acetate?
The canonical SMILES for [(1R)-2-oxocyclohexyl] 2-(4-benzoylphenoxy)acetate is O=C(COc1ccc(C(=O)c2ccccc2)cc1)O[C@@H]1CCCCC1=O.
What is the InChIKey of [(1R)-2-oxocyclohexyl] 2-(4-benzoylphenoxy)acetate?
The InChIKey is SEKAIBGIVYHIBX-LJQANCHMSA-N. The full InChI is InChI=1S/C21H20O5/c22-18-8-4-5-9-19(18)26-20(23)14-25-17-12-10-16(11-13-17)21(24)15-6-2-1-3-7-15/h1-3,6-7,10-13,19H,4-5,8-9,14H2/t19-/m1/s1.
What are the key properties of [(1R)-2-oxocyclohexyl] 2-(4-benzoylphenoxy)acetate?
[(1R)-2-oxocyclohexyl] 2-(4-benzoylphenoxy)acetate has a molecular weight of 352.39 g/mol, XLogP of 3.35, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-2-oxocyclohexyl] 2-(4-benzoylphenoxy)acetate is sourced from PubChem (CID 7839651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).