C39H56O10 — CID 78410139
(6'-but-2-en-2-yl-3',24-dihydroxy-21-methoxy-5',11,13,22-tetramethyl-2-oxospiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-12-yl) 2-methylpropanoate (PubChem CID 78410139) has the molecular formula C39H56O10 and a molecular weight of 684.87 g/mol. Its IUPAC name is (6'-but-2-en-2-yl-3',24-dihydroxy-21-methoxy-5',11,13,22-tetramethyl-2-oxospiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-12-yl) 2-methylpropanoate.
| Compound Name | (6'-but-2-en-2-yl-3',24-dihydroxy-21-methoxy-5',11,13,22-tetramethyl-2-oxospiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-12-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 78410139 |
| Molecular Formula | C39H56O10 |
| Molecular Weight | 684.87 g/mol |
| Exact Mass | 684.39 |
| IUPAC Name | (6'-but-2-en-2-yl-3',24-dihydroxy-21-methoxy-5',11,13,22-tetramethyl-2-oxospiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-12-yl) 2-methylpropanoate |
| SMILES | CC=C(C)C1OC2(CC3CC(CC=C(C)C(OC(=O)C(C)C)C(C)C=CC=C4COC5C(OC)C(C)=CC(C(=O)O3)C45O)O2)C(O)CC1C |
| InChI | InChI=1S/C39H56O10/c1-10-22(4)33-26(8)17-31(40)38(49-33)19-29-18-28(48-38)15-14-24(6)32(47-36(41)21(2)3)23(5)12-11-13-27-20-45-35-34(44-9)25(7)16-30(37(42)46-29)39(27,35)43/h10-14,16,21,23,26,28-35,40,43H,15,17-20H2,1-9H3 |
| InChIKey | OSQLEUPDNRRMMI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.87 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|