C35H50O9 — CID 163044290
6'-but-2-en-2-yl-3',12,24-trihydroxy-21-methoxy-5',11,13,22-tetramethylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one (PubChem CID 163044290) has the molecular formula C35H50O9 and a molecular weight of 614.78 g/mol. Its IUPAC name is 6'-but-2-en-2-yl-3',12,24-trihydroxy-21-methoxy-5',11,13,22-tetramethylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one.
| Compound Name | 6'-but-2-en-2-yl-3',12,24-trihydroxy-21-methoxy-5',11,13,22-tetramethylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one |
|---|---|
| PubChem CID | 163044290 |
| Molecular Formula | C35H50O9 |
| Molecular Weight | 614.78 g/mol |
| Exact Mass | 614.35 |
| IUPAC Name | 6'-but-2-en-2-yl-3',12,24-trihydroxy-21-methoxy-5',11,13,22-tetramethylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one |
| SMILES | CC=C(C)C1OC2(CC3CC(CC=C(C)C(O)C(C)C=CC=C4COC5C(OC)C(C)=CC(C(=O)O3)C45O)O2)C(O)CC1C |
| InChI | InChI=1S/C35H50O9/c1-8-19(2)30-23(6)15-28(36)34(44-30)17-26-16-25(43-34)13-12-21(4)29(37)20(3)10-9-11-24-18-41-32-31(40-7)22(5)14-27(33(38)42-26)35(24,32)39/h8-12,14,20,23,25-32,36-37,39H,13,15-18H2,1-7H3 |
| InChIKey | GDYDDJBUQFLUBD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.78 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|