C38H54O10 — CID 78410138
(6'-but-2-en-2-yl-3',21,24-trihydroxy-5',11,13,22-tetramethyl-2-oxospiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-12-yl) 2-methylpropanoate (PubChem CID 78410138) has the molecular formula C38H54O10 and a molecular weight of 670.84 g/mol. Its IUPAC name is (6'-but-2-en-2-yl-3',21,24-trihydroxy-5',11,13,22-tetramethyl-2-oxospiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-12-yl) 2-methylpropanoate.
| Compound Name | (6'-but-2-en-2-yl-3',21,24-trihydroxy-5',11,13,22-tetramethyl-2-oxospiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-12-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 78410138 |
| Molecular Formula | C38H54O10 |
| Molecular Weight | 670.84 g/mol |
| Exact Mass | 670.37 |
| IUPAC Name | (6'-but-2-en-2-yl-3',21,24-trihydroxy-5',11,13,22-tetramethyl-2-oxospiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-12-yl) 2-methylpropanoate |
| SMILES | CC=C(C)C1OC2(CC3CC(CC=C(C)C(OC(=O)C(C)C)C(C)C=CC=C4COC5C(O)C(C)=CC(C(=O)O3)C45O)O2)C(O)CC1C |
| InChI | InChI=1S/C38H54O10/c1-9-21(4)33-25(8)16-30(39)37(48-33)18-28-17-27(47-37)14-13-23(6)32(46-35(41)20(2)3)22(5)11-10-12-26-19-44-34-31(40)24(7)15-29(36(42)45-28)38(26,34)43/h9-13,15,20,22,25,27-34,39-40,43H,14,16-19H2,1-8H3 |
| InChIKey | AAYIADJXSCBLCS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.84 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|