C23H33NO8S — CID 78410471
13-(2-acetamido-2-carboxyethyl)sulfanyl-14-hydroxyoctadeca-4,7,9,11-tetraenedioic acid (PubChem CID 78410471) has the molecular formula C23H33NO8S and a molecular weight of 483.58 g/mol. Its IUPAC name is 13-(2-acetamido-2-carboxyethyl)sulfanyl-14-hydroxyoctadeca-4,7,9,11-tetraenedioic acid.
| Compound Name | 13-(2-acetamido-2-carboxyethyl)sulfanyl-14-hydroxyoctadeca-4,7,9,11-tetraenedioic acid |
|---|---|
| PubChem CID | 78410471 |
| Molecular Formula | C23H33NO8S |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 13-(2-acetamido-2-carboxyethyl)sulfanyl-14-hydroxyoctadeca-4,7,9,11-tetraenedioic acid |
| SMILES | CC(=O)NC(CSC(C=CC=CC=CCC=CCCC(=O)O)C(O)CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H33NO8S/c1-17(25)24-18(23(31)32)16-33-20(19(26)12-11-15-22(29)30)13-9-7-5-3-2-4-6-8-10-14-21(27)28/h2-3,5-9,13,18-20,26H,4,10-12,14-16H2,1H3,(H,24,25)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | QGAYARJCHQVTKP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|