C18H24N2O2 — CID 78411686
3-ethyl-1-[(3-methylphenyl)methyl]-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione (PubChem CID 78411686) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-ethyl-1-[(3-methylphenyl)methyl]-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione.
| Compound Name | 3-ethyl-1-[(3-methylphenyl)methyl]-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 78411686 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 3-ethyl-1-[(3-methylphenyl)methyl]-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione |
| SMILES | CCN1C(=O)C2CCCCC2N(Cc2cccc(C)c2)C1=O |
| InChI | InChI=1S/C18H24N2O2/c1-3-19-17(21)15-9-4-5-10-16(15)20(18(19)22)12-14-8-6-7-13(2)11-14/h6-8,11,15-16H,3-5,9-10,12H2,1-2H3 |
| InChIKey | ZWIUWIYUFORRCW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |