C14H16F3NO — CID 177029919
1-[(3-methylphenyl)methyl]-6-(trifluoromethyl)piperidin-2-one (PubChem CID 177029919) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is 1-[(3-methylphenyl)methyl]-6-(trifluoromethyl)piperidin-2-one.
| Compound Name | 1-[(3-methylphenyl)methyl]-6-(trifluoromethyl)piperidin-2-one |
|---|---|
| PubChem CID | 177029919 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 1-[(3-methylphenyl)methyl]-6-(trifluoromethyl)piperidin-2-one |
| SMILES | Cc1cccc(CN2C(=O)CCCC2C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F3NO/c1-10-4-2-5-11(8-10)9-18-12(14(15,16)17)6-3-7-13(18)19/h2,4-5,8,12H,3,6-7,9H2,1H3 |
| InChIKey | QFLOAONSHAOQMJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |