C9H6N2O3S3 — CID 78416913
2-[4-oxo-2-sulfanylidene-5-(1,3-thiazol-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 78416913) has the molecular formula C9H6N2O3S3 and a molecular weight of 286.36 g/mol. Its IUPAC name is 2-[4-oxo-2-sulfanylidene-5-(1,3-thiazol-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[4-oxo-2-sulfanylidene-5-(1,3-thiazol-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 78416913 |
| Molecular Formula | C9H6N2O3S3 |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 285.95 |
| IUPAC Name | 2-[4-oxo-2-sulfanylidene-5-(1,3-thiazol-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C(=Cc2nccs2)SC1=S |
| InChI | InChI=1S/C9H6N2O3S3/c12-7(13)4-11-8(14)5(17-9(11)15)3-6-10-1-2-16-6/h1-3H,4H2,(H,12,13) |
| InChIKey | NXNJQVJDNPNFES-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|