C22H18FNO3S — CID 7842743
[2-(3-fluoroanilino)-2-oxoethyl] (2R)-2-phenyl-2-phenylsulfanylacetate (PubChem CID 7842743) has the molecular formula C22H18FNO3S and a molecular weight of 395.46 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] (2R)-2-phenyl-2-phenylsulfanylacetate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] (2R)-2-phenyl-2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 7842743 |
| Molecular Formula | C22H18FNO3S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] (2R)-2-phenyl-2-phenylsulfanylacetate |
| SMILES | O=C(COC(=O)[C@H](Sc1ccccc1)c1ccccc1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C22H18FNO3S/c23-17-10-7-11-18(14-17)24-20(25)15-27-22(26)21(16-8-3-1-4-9-16)28-19-12-5-2-6-13-19/h1-14,21H,15H2,(H,24,25)/t21-/m1/s1 |
| InChIKey | QQEDAGLNPQPCAD-OAQYLSRUSA-N |
| XLogP | 4.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |