C22H20FN3O2 — CID 9372367
2-[(E)-(1-amino-2,2-diphenylethylidene)amino]oxy-N-(3-fluorophenyl)acetamide (PubChem CID 9372367) has the molecular formula C22H20FN3O2 and a molecular weight of 377.42 g/mol. Its IUPAC name is 2-[(E)-(1-amino-2,2-diphenylethylidene)amino]oxy-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[(E)-(1-amino-2,2-diphenylethylidene)amino]oxy-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 9372367 |
| Molecular Formula | C22H20FN3O2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-[(E)-(1-amino-2,2-diphenylethylidene)amino]oxy-N-(3-fluorophenyl)acetamide |
| SMILES | N/C(=N/OCC(=O)Nc1cccc(F)c1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20FN3O2/c23-18-12-7-13-19(14-18)25-20(27)15-28-26-22(24)21(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-14,21H,15H2,(H2,24,26)(H,25,27) |
| InChIKey | VFKABZVTUZKMRD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|