C17H16ClFN4O3 — CID 78766839
3-amino-N-(2-chlorophenyl)-3-[2-(3-fluoroanilino)-2-oxoethoxy]iminopropanamide (PubChem CID 78766839) has the molecular formula C17H16ClFN4O3 and a molecular weight of 378.79 g/mol. Its IUPAC name is 3-amino-N-(2-chlorophenyl)-3-[2-(3-fluoroanilino)-2-oxoethoxy]iminopropanamide.
| Compound Name | 3-amino-N-(2-chlorophenyl)-3-[2-(3-fluoroanilino)-2-oxoethoxy]iminopropanamide |
|---|---|
| PubChem CID | 78766839 |
| Molecular Formula | C17H16ClFN4O3 |
| Molecular Weight | 378.79 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 3-amino-N-(2-chlorophenyl)-3-[2-(3-fluoroanilino)-2-oxoethoxy]iminopropanamide |
| SMILES | NC(CC(=O)Nc1ccccc1Cl)=NOCC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C17H16ClFN4O3/c18-13-6-1-2-7-14(13)22-16(24)9-15(20)23-26-10-17(25)21-12-5-3-4-11(19)8-12/h1-8H,9-10H2,(H2,20,23)(H,21,25)(H,22,24) |
| InChIKey | OFZOLDMMFNUTPZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.79 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|