C16H14Cl2FN3O2 — CID 78766790
3-amino-3-[(2-chloro-6-fluorophenyl)methoxyimino]-N-(2-chlorophenyl)propanamide (PubChem CID 78766790) has the molecular formula C16H14Cl2FN3O2 and a molecular weight of 370.21 g/mol. Its IUPAC name is 3-amino-3-[(2-chloro-6-fluorophenyl)methoxyimino]-N-(2-chlorophenyl)propanamide.
| Compound Name | 3-amino-3-[(2-chloro-6-fluorophenyl)methoxyimino]-N-(2-chlorophenyl)propanamide |
|---|---|
| PubChem CID | 78766790 |
| Molecular Formula | C16H14Cl2FN3O2 |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 3-amino-3-[(2-chloro-6-fluorophenyl)methoxyimino]-N-(2-chlorophenyl)propanamide |
| SMILES | NC(CC(=O)Nc1ccccc1Cl)=NOCc1c(F)cccc1Cl |
| InChI | InChI=1S/C16H14Cl2FN3O2/c17-11-5-3-6-13(19)10(11)9-24-22-15(20)8-16(23)21-14-7-2-1-4-12(14)18/h1-7H,8-9H2,(H2,20,22)(H,21,23) |
| InChIKey | SCVYCCRNTILUIJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|