C20H23ClN4O3 — CID 78766800
(3E)-3-amino-N-(2-chlorophenyl)-3-[2-oxo-2-(4-propan-2-ylanilino)ethoxy]iminopropanamide (PubChem CID 78766800) has the molecular formula C20H23ClN4O3 and a molecular weight of 402.88 g/mol. Its IUPAC name is (3E)-3-amino-N-(2-chlorophenyl)-3-[2-oxo-2-(4-propan-2-ylanilino)ethoxy]iminopropanamide.
| Compound Name | (3E)-3-amino-N-(2-chlorophenyl)-3-[2-oxo-2-(4-propan-2-ylanilino)ethoxy]iminopropanamide |
|---|---|
| PubChem CID | 78766800 |
| Molecular Formula | C20H23ClN4O3 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (3E)-3-amino-N-(2-chlorophenyl)-3-[2-oxo-2-(4-propan-2-ylanilino)ethoxy]iminopropanamide |
| SMILES | CC(C)c1ccc(NC(=O)CO/N=C(/N)CC(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H23ClN4O3/c1-13(2)14-7-9-15(10-8-14)23-20(27)12-28-25-18(22)11-19(26)24-17-6-4-3-5-16(17)21/h3-10,13H,11-12H2,1-2H3,(H2,22,25)(H,23,27)(H,24,26) |
| InChIKey | HEDIZGKJWSOTEQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|