C19H20Cl2N4O3 — CID 78820528
(3E)-3-amino-N-(2-chlorophenyl)-3-[1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl]oxyiminopropanamide (PubChem CID 78820528) has the molecular formula C19H20Cl2N4O3 and a molecular weight of 423.30 g/mol. Its IUPAC name is (3E)-3-amino-N-(2-chlorophenyl)-3-[1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl]oxyiminopropanamide.
| Compound Name | (3E)-3-amino-N-(2-chlorophenyl)-3-[1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl]oxyiminopropanamide |
|---|---|
| PubChem CID | 78820528 |
| Molecular Formula | C19H20Cl2N4O3 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | (3E)-3-amino-N-(2-chlorophenyl)-3-[1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl]oxyiminopropanamide |
| SMILES | CC(O/N=C(/N)CC(=O)Nc1ccccc1Cl)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C19H20Cl2N4O3/c1-12(19(27)23-11-13-6-2-3-7-14(13)20)28-25-17(22)10-18(26)24-16-9-5-4-8-15(16)21/h2-9,12H,10-11H2,1H3,(H2,22,25)(H,23,27)(H,24,26) |
| InChIKey | HAXGNKVOYHNZRF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|